C9H8F5O7S- — CID 58352280
1,1-difluoro-2-[3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)propanoyl]oxyethanesulfonate (PubChem CID 58352280) has the molecular formula C9H8F5O7S- and a molecular weight of 355.21 g/mol. Its IUPAC name is 1,1-difluoro-2-[3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)propanoyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)propanoyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 58352280 |
| Molecular Formula | C9H8F5O7S- |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 1,1-difluoro-2-[3,3,3-trifluoro-2-(2-methylprop-2-enoyloxy)propanoyl]oxyethanesulfonate |
| SMILES | C=C(C)C(=O)OC(C(=O)OCC(F)(F)S(=O)(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C9H9F5O7S/c1-4(2)6(15)21-5(9(12,13)14)7(16)20-3-8(10,11)22(17,18)19/h5H,1,3H2,2H3,(H,17,18,19)/p-1 |
| InChIKey | VXMOXDDLVLQSNY-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|