C11H14F4O7S — CID 58352288
2-[2,2-difluoro-3-methyl-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 58352288) has the molecular formula C11H14F4O7S and a molecular weight of 366.29 g/mol. Its IUPAC name is 2-[2,2-difluoro-3-methyl-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2,2-difluoro-3-methyl-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58352288 |
| Molecular Formula | C11H14F4O7S |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-[2,2-difluoro-3-methyl-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)(C)C(F)(F)C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H14F4O7S/c1-6(2)7(16)22-9(3,4)11(14,15)8(17)21-5-10(12,13)23(18,19)20/h1,5H2,2-4H3,(H,18,19,20) |
| InChIKey | VYGUITVCJOQMEF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|