C9H10F3O7S- — CID 58352371
1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)butanoyloxy]ethanesulfonate (PubChem CID 58352371) has the molecular formula C9H10F3O7S- and a molecular weight of 319.23 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)butanoyloxy]ethanesulfonate.
| Compound Name | 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)butanoyloxy]ethanesulfonate |
|---|---|
| PubChem CID | 58352371 |
| Molecular Formula | C9H10F3O7S- |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 1,1-difluoro-2-[3-(2-fluoroprop-2-enoyloxy)butanoyloxy]ethanesulfonate |
| SMILES | C=C(F)C(=O)OC(C)CC(=O)OCC(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H11F3O7S/c1-5(19-8(14)6(2)10)3-7(13)18-4-9(11,12)20(15,16)17/h5H,2-4H2,1H3,(H,15,16,17)/p-1 |
| InChIKey | JKHMWBFBJYCRGA-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|