C31H36F3N3NaO4- — CID 58352891
sodium;4-[2-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]-N-(3-oxopropyl)benzamide;hydroxide (PubChem CID 58352891) has the molecular formula C31H36F3N3NaO4- and a molecular weight of 594.63 g/mol. Its IUPAC name is sodium;4-[2-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]-N-(3-oxopropyl)benzamide;hydroxide.
| Compound Name | sodium;4-[2-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]-N-(3-oxopropyl)benzamide;hydroxide |
|---|---|
| PubChem CID | 58352891 |
| Molecular Formula | C31H36F3N3NaO4- |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | sodium;4-[2-[8-tert-butyl-3-oxo-2-[3-(trifluoromethyl)phenyl]-1,4-diazaspiro[4.5]dec-1-en-4-yl]ethyl]-N-(3-oxopropyl)benzamide;hydroxide |
| SMILES | CC(C)(C)C1CCC2(CC1)N=C(c1cccc(C(F)(F)F)c1)C(=O)N2CCc1ccc(C(=O)NCC[C-]=O)cc1.[Na+].[OH-] |
| InChI | InChI=1S/C31H35F3N3O3.Na.H2O/c1-29(2,3)24-12-15-30(16-13-24)36-26(23-6-4-7-25(20-23)31(32,33)34)28(40)37(30)18-14-21-8-10-22(11-9-21)27(39)35-17-5-19-38;;/h4,6-11,20,24H,5,12-18H2,1-3H3,(H,35,39);;1H2/q-1;+1;/p-1 |
| InChIKey | OWNZMYQMAAVWTF-UHFFFAOYSA-M |
| XLogP | 2.57 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|