C28H32FN3O2 — CID 58353423
CID 58353423 (PubChem CID 58353423) has the molecular formula C28H32FN3O2 and a molecular weight of 461.58 g/mol.
| Compound Name | CID 58353423 |
|---|---|
| PubChem CID | 58353423 |
| Molecular Formula | C28H32FN3O2 |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | — |
| SMILES | [CH]CNC(=O)c1ccc(CN2C(=O)C(c3ccc(F)cc3)=NC23CCC(C(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C28H32FN3O2/c1-5-30-25(33)21-8-6-19(7-9-21)18-32-26(34)24(20-10-12-23(29)13-11-20)31-28(32)16-14-22(15-17-28)27(2,3)4/h1,6-13,22H,5,14-18H2,2-4H3,(H,30,33) |
| InChIKey | HZGNVPWYHAVACY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |