About 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol
2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol (PubChem CID 583538) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
| PubChem CID | 583538 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol |
| SMILES | Cc1nonc1/N=C/c1ccccc1O |
| InChI | InChI=1S/C10H9N3O2/c1-7-10(13-15-12-7)11-6-8-4-2-3-5-9(8)14/h2-6,14H,1H3/b11-6+ |
| InChIKey | KKXRCFFPGVTIEY-IZZDOVSWSA-N |
| XLogP | 1.83 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The IUPAC name of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol (CID 583538) is 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol.
What is the SMILES notation for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The canonical SMILES for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol is Cc1nonc1/N=C/c1ccccc1O.
What is the InChIKey of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
The InChIKey is KKXRCFFPGVTIEY-IZZDOVSWSA-N. The full InChI is InChI=1S/C10H9N3O2/c1-7-10(13-15-12-7)11-6-8-4-2-3-5-9(8)14/h2-6,14H,1H3/b11-6+.
What are the key properties of 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol?
2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol has a molecular weight of 203.20 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,2,5-oxadiazol-3-yl)iminomethyl]phenol is sourced from PubChem (CID 583538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).