C26H25N5O — CID 58354579
N,N-dimethyl-3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propan-1-amine (PubChem CID 58354579) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 58354579 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N,N-dimethyl-3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2cnc3[nH]c4cnc(-c5cccnc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C26H25N5O/c1-31(2)11-4-12-32-21-8-6-18(7-9-21)20-13-23-22-14-24(19-5-3-10-27-15-19)28-17-25(22)30-26(23)29-16-20/h3,5-10,13-17H,4,11-12H2,1-2H3,(H,29,30) |
| InChIKey | CGYAXUNRKYOADI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|