C23H18FN5O — CID 58354583
4-(12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyaniline (PubChem CID 58354583) has the molecular formula C23H18FN5O and a molecular weight of 399.43 g/mol. Its IUPAC name is 4-(12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyaniline.
| Compound Name | 4-(12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 58354583 |
| Molecular Formula | C23H18FN5O |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-(12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-2-methoxyaniline |
| SMILES | COc1cc(-c2c(F)cnc3c2c2cc(-c4cccnc4)ncc2n3C)ccc1N |
| InChI | InChI=1S/C23H18FN5O/c1-29-19-12-27-18(14-4-3-7-26-10-14)9-15(19)22-21(16(24)11-28-23(22)29)13-5-6-17(25)20(8-13)30-2/h3-12H,25H2,1-2H3 |
| InChIKey | RZNDSNIMEFKDAZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|