C11H5F4N3O3S — CID 58354584
(12-fluoro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate (PubChem CID 58354584) has the molecular formula C11H5F4N3O3S and a molecular weight of 335.24 g/mol. Its IUPAC name is (12-fluoro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate.
| Compound Name | (12-fluoro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58354584 |
| Molecular Formula | C11H5F4N3O3S |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (12-fluoro-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cn1)[nH]c1ncc(F)cc12)C(F)(F)F |
| InChI | InChI=1S/C11H5F4N3O3S/c12-5-1-7-6-2-9(21-22(19,20)11(13,14)15)16-4-8(6)18-10(7)17-3-5/h1-4H,(H,17,18) |
| InChIKey | PFFLCIUGXKVYKC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|