C12H8F3N3O4S — CID 58354586
(12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate (PubChem CID 58354586) has the molecular formula C12H8F3N3O4S and a molecular weight of 347.27 g/mol. Its IUPAC name is (12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate.
| Compound Name | (12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58354586 |
| Molecular Formula | C12H8F3N3O4S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl) trifluoromethanesulfonate |
| SMILES | COc1cnc2[nH]c3cnc(OS(=O)(=O)C(F)(F)F)cc3c2c1 |
| InChI | InChI=1S/C12H8F3N3O4S/c1-21-6-2-8-7-3-10(22-23(19,20)12(13,14)15)16-5-9(7)18-11(8)17-4-6/h2-5H,1H3,(H,17,18) |
| InChIKey | BYVLTWYQVKVNJS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|