C26H24FN5O — CID 58354595
N-ethyl-3-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]propan-1-amine (PubChem CID 58354595) has the molecular formula C26H24FN5O and a molecular weight of 441.51 g/mol. Its IUPAC name is N-ethyl-3-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]propan-1-amine.
| Compound Name | N-ethyl-3-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 58354595 |
| Molecular Formula | C26H24FN5O |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-ethyl-3-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]propan-1-amine |
| SMILES | CCNCCCOc1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)cc1 |
| InChI | InChI=1S/C26H24FN5O/c1-2-28-11-4-12-33-19-8-6-17(7-9-19)24-21(27)15-31-26-25(24)20-13-22(30-16-23(20)32-26)18-5-3-10-29-14-18/h3,5-10,13-16,28H,2,4,11-12H2,1H3,(H,31,32) |
| InChIKey | DDTJHXNMSPJBCF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|