C26H26N6 — CID 58354621
N,N,4-triethyl-5-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)pyridin-2-amine (PubChem CID 58354621) has the molecular formula C26H26N6 and a molecular weight of 422.54 g/mol. Its IUPAC name is N,N,4-triethyl-5-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)pyridin-2-amine.
| Compound Name | N,N,4-triethyl-5-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 58354621 |
| Molecular Formula | C26H26N6 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N,N,4-triethyl-5-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)pyridin-2-amine |
| SMILES | CCc1cc(N(CC)CC)ncc1-c1cnc2[nH]c3cnc(-c4cccnc4)cc3c2c1 |
| InChI | InChI=1S/C26H26N6/c1-4-17-11-25(32(5-2)6-3)29-15-22(17)19-10-21-20-12-23(18-8-7-9-27-13-18)28-16-24(20)31-26(21)30-14-19/h7-16H,4-6H2,1-3H3,(H,30,31) |
| InChIKey | DECSSMAILVXURC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |