C29H29N5O3 — CID 58354629
tert-butyl N-[3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propyl]carbamate (PubChem CID 58354629) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 58354629 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | tert-butyl N-[3-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc(-c2cnc3[nH]c4cnc(-c5cccnc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C29H29N5O3/c1-29(2,3)37-28(35)31-12-5-13-36-22-9-7-19(8-10-22)21-14-24-23-15-25(20-6-4-11-30-16-20)32-18-26(23)34-27(24)33-17-21/h4,6-11,14-18H,5,12-13H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | KAIQDDUEDDAESM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|