C23H28N6O3 — CID 58354651
tert-butyl N-[4-[4-(12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)pyrazol-1-yl]butyl]carbamate (PubChem CID 58354651) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)pyrazol-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)pyrazol-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 58354651 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tert-butyl N-[4-[4-(12-methoxy-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-4-yl)pyrazol-1-yl]butyl]carbamate |
| SMILES | COc1cnc2[nH]c3cnc(-c4cnn(CCCCNC(=O)OC(C)(C)C)c4)cc3c2c1 |
| InChI | InChI=1S/C23H28N6O3/c1-23(2,3)32-22(30)24-7-5-6-8-29-14-15(11-27-29)19-10-17-18-9-16(31-4)12-26-21(18)28-20(17)13-25-19/h9-14H,5-8H2,1-4H3,(H,24,30)(H,26,28) |
| InChIKey | CEECVOKPZXABGE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|