C20H33BN2O5S — CID 58354667
1-methylsulfonyl-4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]piperazine (PubChem CID 58354667) has the molecular formula C20H33BN2O5S and a molecular weight of 424.37 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]piperazine.
| Compound Name | 1-methylsulfonyl-4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]piperazine |
|---|---|
| PubChem CID | 58354667 |
| Molecular Formula | C20H33BN2O5S |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-methylsulfonyl-4-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]piperazine |
| SMILES | CC1(C)OB(c2ccc(OCCCN3CCN(S(C)(=O)=O)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H33BN2O5S/c1-19(2)20(3,4)28-21(27-19)17-7-9-18(10-8-17)26-16-6-11-22-12-14-23(15-13-22)29(5,24)25/h7-10H,6,11-16H2,1-5H3 |
| InChIKey | IJODIUVKFDDYFO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|