C19H19FN4Sn — CID 58354682
(12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-trimethylstannane (PubChem CID 58354682) has the molecular formula C19H19FN4Sn and a molecular weight of 441.10 g/mol. Its IUPAC name is (12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-trimethylstannane.
| Compound Name | (12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-trimethylstannane |
|---|---|
| PubChem CID | 58354682 |
| Molecular Formula | C19H19FN4Sn |
| Molecular Weight | 441.10 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (12-fluoro-8-methyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)-trimethylstannane |
| SMILES | Cn1c2cnc(-c3cccnc3)cc2c2c([Sn](C)(C)C)c(F)cnc21 |
| InChI | InChI=1S/C16H10FN4.3CH3.Sn/c1-21-15-9-19-14(10-3-2-4-18-7-10)6-12(15)13-5-11(17)8-20-16(13)21;;;;/h2-4,6-9H,1H3;3*1H3; |
| InChIKey | RJSDGNKDJWXSFE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.10 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |