C16H11FN4O — CID 58354691
12-fluoro-13-methoxy-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 58354691) has the molecular formula C16H11FN4O and a molecular weight of 294.29 g/mol. Its IUPAC name is 12-fluoro-13-methoxy-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-methoxy-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 58354691 |
| Molecular Formula | C16H11FN4O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 12-fluoro-13-methoxy-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | COc1c(F)cnc2[nH]c3cnc(-c4cccnc4)cc3c12 |
| InChI | InChI=1S/C16H11FN4O/c1-22-15-11(17)7-20-16-14(15)10-5-12(19-8-13(10)21-16)9-3-2-4-18-6-9/h2-8H,1H3,(H,20,21) |
| InChIKey | FQBCCPKQVBYETA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |