C27H26FN5O — CID 58354692
N,N-diethyl-2-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]ethanamine (PubChem CID 58354692) has the molecular formula C27H26FN5O and a molecular weight of 455.54 g/mol. Its IUPAC name is N,N-diethyl-2-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 58354692 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N,N-diethyl-2-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenoxy]ethanamine |
| SMILES | CCN(CC)CCOc1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)cc1 |
| InChI | InChI=1S/C27H26FN5O/c1-3-33(4-2)12-13-34-20-9-7-18(8-10-20)25-22(28)16-31-27-26(25)21-14-23(30-17-24(21)32-27)19-6-5-11-29-15-19/h5-11,14-17H,3-4,12-13H2,1-2H3,(H,31,32) |
| InChIKey | VYPAOXVKCIAUGE-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |