C12H10FN3O — CID 58354706
12-fluoro-4-methoxy-8-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354706) has the molecular formula C12H10FN3O and a molecular weight of 231.23 g/mol. Its IUPAC name is 12-fluoro-4-methoxy-8-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-fluoro-4-methoxy-8-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354706 |
| Molecular Formula | C12H10FN3O |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 12-fluoro-4-methoxy-8-methyl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | COc1cc2c3cc(F)cnc3n(C)c2cn1 |
| InChI | InChI=1S/C12H10FN3O/c1-16-10-6-14-11(17-2)4-8(10)9-3-7(13)5-15-12(9)16/h3-6H,1-2H3 |
| InChIKey | BOJBTLOAQKKGDA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |