C27H32FN7 — CID 58354708
12-fluoro-13-[4-(3-piperidin-1-ylpropyl)piperazin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 58354708) has the molecular formula C27H32FN7 and a molecular weight of 473.60 g/mol. Its IUPAC name is 12-fluoro-13-[4-(3-piperidin-1-ylpropyl)piperazin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-[4-(3-piperidin-1-ylpropyl)piperazin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 58354708 |
| Molecular Formula | C27H32FN7 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 12-fluoro-13-[4-(3-piperidin-1-ylpropyl)piperazin-1-yl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Fc1cnc2[nH]c3cnc(-c4cccnc4)cc3c2c1N1CCN(CCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C27H32FN7/c28-22-18-31-27-25(21-16-23(30-19-24(21)32-27)20-6-4-7-29-17-20)26(22)35-14-12-34(13-15-35)11-5-10-33-8-2-1-3-9-33/h4,6-7,16-19H,1-3,5,8-15H2,(H,31,32) |
| InChIKey | UJZVKDFTNVJDPE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 64.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |