C27H24FN5O — CID 58354712
12-fluoro-4-pyridin-3-yl-13-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 58354712) has the molecular formula C27H24FN5O and a molecular weight of 453.52 g/mol. Its IUPAC name is 12-fluoro-4-pyridin-3-yl-13-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-4-pyridin-3-yl-13-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 58354712 |
| Molecular Formula | C27H24FN5O |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 12-fluoro-4-pyridin-3-yl-13-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Fc1cnc2[nH]c3cnc(-c4cccnc4)cc3c2c1-c1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C27H24FN5O/c28-22-16-31-27-26(21-14-23(30-17-24(21)32-27)19-4-3-9-29-15-19)25(22)18-5-7-20(8-6-18)34-13-12-33-10-1-2-11-33/h3-9,14-17H,1-2,10-13H2,(H,31,32) |
| InChIKey | JOXZFBLPWGLWAY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |