C29H29N5O — CID 58354734
12-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354734) has the molecular formula C29H29N5O and a molecular weight of 463.59 g/mol. Its IUPAC name is 12-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354734 |
| Molecular Formula | C29H29N5O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 12-[4-(3-piperidin-1-ylpropoxy)phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1cncc(-c2cc3c(cn2)[nH]c2ncc(-c4ccc(OCCCN5CCCCC5)cc4)cc23)c1 |
| InChI | InChI=1S/C29H29N5O/c1-2-12-34(13-3-1)14-5-15-35-24-9-7-21(8-10-24)23-16-26-25-17-27(22-6-4-11-30-18-22)31-20-28(25)33-29(26)32-19-23/h4,6-11,16-20H,1-3,5,12-15H2,(H,32,33) |
| InChIKey | QGNAEZMXKFRNNS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|