C19H12F3N3O5S — CID 58354742
methyl 4-[4-(trifluoromethylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate (PubChem CID 58354742) has the molecular formula C19H12F3N3O5S and a molecular weight of 451.38 g/mol. Its IUPAC name is methyl 4-[4-(trifluoromethylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate.
| Compound Name | methyl 4-[4-(trifluoromethylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate |
|---|---|
| PubChem CID | 58354742 |
| Molecular Formula | C19H12F3N3O5S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | methyl 4-[4-(trifluoromethylsulfonyloxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccnc3[nH]c4cnc(OS(=O)(=O)C(F)(F)F)cc4c23)cc1 |
| InChI | InChI=1S/C19H12F3N3O5S/c1-29-18(26)11-4-2-10(3-5-11)12-6-7-23-17-16(12)13-8-15(24-9-14(13)25-17)30-31(27,28)19(20,21)22/h2-9H,1H3,(H,23,25) |
| InChIKey | MHCBWUYOAIOOSR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|