C27H25N5O2 — CID 58354745
4-[2-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethyl]morpholine (PubChem CID 58354745) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 4-[2-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 58354745 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[2-[4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethyl]morpholine |
| SMILES | c1cncc(-c2cc3c(cn2)[nH]c2ncc(-c4ccc(OCCN5CCOCC5)cc4)cc23)c1 |
| InChI | InChI=1S/C27H25N5O2/c1-2-20(16-28-7-1)25-15-23-24-14-21(17-30-27(24)31-26(23)18-29-25)19-3-5-22(6-4-19)34-13-10-32-8-11-33-12-9-32/h1-7,14-18H,8-13H2,(H,30,31) |
| InChIKey | WDFNPFJDMWMTCY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |