C17H11F3N4O — CID 58354774
4-pyridin-3-yl-12-(2,2,2-trifluoroethoxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354774) has the molecular formula C17H11F3N4O and a molecular weight of 344.30 g/mol. Its IUPAC name is 4-pyridin-3-yl-12-(2,2,2-trifluoroethoxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-pyridin-3-yl-12-(2,2,2-trifluoroethoxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354774 |
| Molecular Formula | C17H11F3N4O |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-pyridin-3-yl-12-(2,2,2-trifluoroethoxy)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | FC(F)(F)COc1cnc2[nH]c3cnc(-c4cccnc4)cc3c2c1 |
| InChI | InChI=1S/C17H11F3N4O/c18-17(19,20)9-25-11-4-13-12-5-14(10-2-1-3-21-6-10)22-8-15(12)24-16(13)23-7-11/h1-8H,9H2,(H,23,24) |
| InChIKey | KDPCOIMBQSYNHN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |