C28H31N5O3 — CID 58354991
2-[[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-pyrrolidin-1-ylethanone (PubChem CID 58354991) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 2-[[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 58354991 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2-[[(1R)-5-[5-(3-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-1-pyrrolidin-1-ylethanone |
| SMILES | [C-]#[N+]c1cc(-c2nc(-c3cccc4c3CCC[C@H]4NCC(=O)N3CCCC3)no2)ccc1OC(C)C |
| InChI | InChI=1S/C28H31N5O3/c1-18(2)35-25-13-12-19(16-24(25)29-3)28-31-27(32-36-28)22-10-6-9-21-20(22)8-7-11-23(21)30-17-26(34)33-14-4-5-15-33/h6,9-10,12-13,16,18,23,30H,4-5,7-8,11,14-15,17H2,1-2H3/t23-/m1/s1 |
| InChIKey | RZQXJNWTYOAEQQ-HSZRJFAPSA-N |
| XLogP | 5.33 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|