C29H41F2N5O5 — CID 58355101
tert-butyl (3S,5R)-3-[[1-(2,3-difluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-formylpiperidine-1-carboxylate (PubChem CID 58355101) has the molecular formula C29H41F2N5O5 and a molecular weight of 577.67 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-[[1-(2,3-difluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-[[1-(2,3-difluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 58355101 |
| Molecular Formula | C29H41F2N5O5 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.31 |
| IUPAC Name | tert-butyl (3S,5R)-3-[[1-(2,3-difluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-formylpiperidine-1-carboxylate |
| SMILES | COCCCCc1c(C(=O)N(CC(C)C)[C@H]2C[C@@H](C=O)CN(C(=O)OC(C)(C)C)C2)nnn1-c1cccc(F)c1F |
| InChI | InChI=1S/C29H41F2N5O5/c1-19(2)15-35(21-14-20(18-37)16-34(17-21)28(39)41-29(3,4)5)27(38)26-24(11-7-8-13-40-6)36(33-32-26)23-12-9-10-22(30)25(23)31/h9-10,12,18-21H,7-8,11,13-17H2,1-6H3/t20-,21+/m1/s1 |
| InChIKey | LEHKIJHSGSIGAO-RTWAWAEBSA-N |
| XLogP | 4.44 |
| TPSA | 106.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|