C30H44FN5O5 — CID 58355207
tert-butyl (3S,5R)-3-[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-(oxiran-2-yl)piperidine-1-carboxylate (PubChem CID 58355207) has the molecular formula C30H44FN5O5 and a molecular weight of 573.71 g/mol. Its IUPAC name is tert-butyl (3S,5R)-3-[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-(oxiran-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-3-[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-(oxiran-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58355207 |
| Molecular Formula | C30H44FN5O5 |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | tert-butyl (3S,5R)-3-[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazole-4-carbonyl]-(2-methylpropyl)amino]-5-(oxiran-2-yl)piperidine-1-carboxylate |
| SMILES | COCCCCc1c(C(=O)N(CC(C)C)[C@H]2C[C@@H](C3CO3)CN(C(=O)OC(C)(C)C)C2)nnn1-c1ccccc1F |
| InChI | InChI=1S/C30H44FN5O5/c1-20(2)16-35(22-15-21(26-19-40-26)17-34(18-22)29(38)41-30(3,4)5)28(37)27-25(13-9-10-14-39-6)36(33-32-27)24-12-8-7-11-23(24)31/h7-8,11-12,20-22,26H,9-10,13-19H2,1-6H3/t21-,22+,26?/m1/s1 |
| InChIKey | FTLYVODSWNYTBE-SGNGHUOJSA-N |
| XLogP | 4.50 |
| TPSA | 102.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|