About 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea
1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea (PubChem CID 58356030) has the molecular formula C17H16ClF3N2O2
and a molecular weight of 372.77 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea.
Molecular Properties
| Compound Name | 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea |
| PubChem CID | 58356030 |
| Molecular Formula | C17H16ClF3N2O2 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea |
| SMILES | CN(C)C(=O)N(C)c1cc(-c2ccc(Cl)cc2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C17H16ClF3N2O2/c1-22(2)16(24)23(3)14-10-12(11-4-7-13(18)8-5-11)6-9-15(14)25-17(19,20)21/h4-10H,1-3H3 |
| InChIKey | HGQAWGLCQCATSO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea?
The IUPAC name of 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea (CID 58356030) is 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea.
What is the SMILES notation for 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea?
The canonical SMILES for 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea is CN(C)C(=O)N(C)c1cc(-c2ccc(Cl)cc2)ccc1OC(F)(F)F.
What is the InChIKey of 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea?
The InChIKey is HGQAWGLCQCATSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClF3N2O2/c1-22(2)16(24)23(3)14-10-12(11-4-7-13(18)8-5-11)6-9-15(14)25-17(19,20)21/h4-10H,1-3H3.
What are the key properties of 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea?
1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea has a molecular weight of 372.77 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-chlorophenyl)-2-(trifluoromethoxy)phenyl]-1,3,3-trimethylurea is sourced from PubChem (CID 58356030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).