C18H26O3 — CID 58356581
(3aS,3bR,5aS,9aS,9bS,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromene-1,7-dione (PubChem CID 58356581) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3aS,3bR,5aS,9aS,9bS,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromene-1,7-dione.
| Compound Name | (3aS,3bR,5aS,9aS,9bS,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromene-1,7-dione |
|---|---|
| PubChem CID | 58356581 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3aS,3bR,5aS,9aS,9bS,11aS)-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromene-1,7-dione |
| SMILES | C[C@]12COC(=O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C18H26O3/c1-17-8-7-14-12(13(17)5-6-15(17)19)4-3-11-9-16(20)21-10-18(11,14)2/h11-14H,3-10H2,1-2H3/t11-,12-,13-,14-,17-,18-/m0/s1 |
| InChIKey | FARSHABWKSMXHH-RJNKSYOCSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |