C18H19ClNO2+ — CID 58356879
[(2S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]methanol (PubChem CID 58356879) has the molecular formula C18H19ClNO2+ and a molecular weight of 316.81 g/mol. Its IUPAC name is [(2S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]methanol.
| Compound Name | [(2S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]methanol |
|---|---|
| PubChem CID | 58356879 |
| Molecular Formula | C18H19ClNO2+ |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [(2S,6S)-9-chloro-4-methyl-13-oxa-4-azoniatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),7(12),8,10,14,16-hexaen-4-yl]methanol |
| SMILES | C[N+]1(CO)C[C@@H]2c3ccccc3Oc3ccc(Cl)cc3[C@H]2C1 |
| InChI | InChI=1S/C18H19ClNO2/c1-20(11-21)9-15-13-4-2-3-5-17(13)22-18-7-6-12(19)8-14(18)16(15)10-20/h2-8,15-16,21H,9-11H2,1H3/q+1/t15-,16-,20?/m1/s1 |
| InChIKey | ZCBFZEPYQPLBPG-KFKFVUQKSA-N |
| XLogP | 3.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|