C16H27NO6 — CID 58356984
tert-butyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 58356984) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 58356984 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | tert-butyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)N[C@@H](CC(=O)OC(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H27NO6/c1-7-8-20-14(19)17-11(9-13(18)23-15(2,3)4)12-10-21-16(5,6)22-12/h7,11-12H,1,8-10H2,2-6H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | WXBZFFYINVVIQX-RYUDHWBXSA-N |
| XLogP | 2.15 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|