C18H30N2O7 — CID 58357108
methyl (2S,6R)-6-(formyloxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]piperidine-2-carboxylate (PubChem CID 58357108) has the molecular formula C18H30N2O7 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl (2S,6R)-6-(formyloxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]piperidine-2-carboxylate.
| Compound Name | methyl (2S,6R)-6-(formyloxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 58357108 |
| Molecular Formula | C18H30N2O7 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | methyl (2S,6R)-6-(formyloxymethyl)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]piperidine-2-carboxylate |
| SMILES | CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1[C@@H](COC=O)CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H30N2O7/c1-6-13(19-17(24)27-18(2,3)4)15(22)20-12(10-26-11-21)8-7-9-14(20)16(23)25-5/h11-14H,6-10H2,1-5H3,(H,19,24)/t12-,13+,14+/m1/s1 |
| InChIKey | BALBSZXVKKHIAW-RDBSUJKOSA-N |
| XLogP | 1.39 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|