About 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine
5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine (PubChem CID 58357219) has the molecular formula C5H3ClN4S
and a molecular weight of 186.63 g/mol. Its IUPAC name is 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| PubChem CID | 58357219 |
| Molecular Formula | C5H3ClN4S |
| Molecular Weight | 186.63 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| SMILES | Nc1nc2cnc(Cl)nc2s1 |
| InChI | InChI=1S/C5H3ClN4S/c6-4-8-1-2-3(10-4)11-5(7)9-2/h1H,(H2,7,9) |
| InChIKey | ONMGRHDYVJLZID-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.63 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The IUPAC name of 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine (CID 58357219) is 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine.
What is the SMILES notation for 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The canonical SMILES for 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine is Nc1nc2cnc(Cl)nc2s1.
What is the InChIKey of 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine?
The InChIKey is ONMGRHDYVJLZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN4S/c6-4-8-1-2-3(10-4)11-5(7)9-2/h1H,(H2,7,9).
What are the key properties of 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine?
5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine has a molecular weight of 186.63 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-[1,3]thiazolo[5,4-d]pyrimidin-2-amine is sourced from PubChem (CID 58357219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).