About 3-(4-methylpentyl)-1,3-thiazolidine
3-(4-methylpentyl)-1,3-thiazolidine (PubChem CID 58357315) has the molecular formula C9H19NS
and a molecular weight of 173.32 g/mol. Its IUPAC name is 3-(4-methylpentyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-(4-methylpentyl)-1,3-thiazolidine |
| PubChem CID | 58357315 |
| Molecular Formula | C9H19NS |
| Molecular Weight | 173.32 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-(4-methylpentyl)-1,3-thiazolidine |
| SMILES | CC(C)CCCN1CCSC1 |
| InChI | InChI=1S/C9H19NS/c1-9(2)4-3-5-10-6-7-11-8-10/h9H,3-8H2,1-2H3 |
| InChIKey | CCXCGUKLWUULNW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-methylpentyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylpentyl)-1,3-thiazolidine?
The IUPAC name of 3-(4-methylpentyl)-1,3-thiazolidine (CID 58357315) is 3-(4-methylpentyl)-1,3-thiazolidine.
What is the SMILES notation for 3-(4-methylpentyl)-1,3-thiazolidine?
The canonical SMILES for 3-(4-methylpentyl)-1,3-thiazolidine is CC(C)CCCN1CCSC1.
What is the InChIKey of 3-(4-methylpentyl)-1,3-thiazolidine?
The InChIKey is CCXCGUKLWUULNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS/c1-9(2)4-3-5-10-6-7-11-8-10/h9H,3-8H2,1-2H3.
What are the key properties of 3-(4-methylpentyl)-1,3-thiazolidine?
3-(4-methylpentyl)-1,3-thiazolidine has a molecular weight of 173.32 g/mol, XLogP of 2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylpentyl)-1,3-thiazolidine is sourced from PubChem (CID 58357315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).