About 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine
3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 58357638) has the molecular formula C19H17N5O2S
and a molecular weight of 379.45 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine |
| PubChem CID | 58357638 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CNc1nn2c(C)cc(-c3cccnc3)nc2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N5O2S/c1-13-11-16(14-7-6-10-21-12-14)22-19-17(18(20-2)23-24(13)19)27(25,26)15-8-4-3-5-9-15/h3-12H,1-2H3,(H,20,23) |
| InChIKey | JKFFGURJCGUBAV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine (CID 58357638) is 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine is CNc1nn2c(C)cc(-c3cccnc3)nc2c1S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is JKFFGURJCGUBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O2S/c1-13-11-16(14-7-6-10-21-12-14)22-19-17(18(20-2)23-24(13)19)27(25,26)15-8-4-3-5-9-15/h3-12H,1-2H3,(H,20,23).
What are the key properties of 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine?
3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 379.45 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N,7-dimethyl-5-pyridin-3-ylpyrazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 58357638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).