C13H26O4Si — CID 58359314
[(3R,4R,5R)-4-triethylsilyloxy-1,6-dioxaspiro[2.5]octan-5-yl]methanol (PubChem CID 58359314) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is [(3R,4R,5R)-4-triethylsilyloxy-1,6-dioxaspiro[2.5]octan-5-yl]methanol.
| Compound Name | [(3R,4R,5R)-4-triethylsilyloxy-1,6-dioxaspiro[2.5]octan-5-yl]methanol |
|---|---|
| PubChem CID | 58359314 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(3R,4R,5R)-4-triethylsilyloxy-1,6-dioxaspiro[2.5]octan-5-yl]methanol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](CO)OCC[C@@]12CO2 |
| InChI | InChI=1S/C13H26O4Si/c1-4-18(5-2,6-3)17-12-11(9-14)15-8-7-13(12)10-16-13/h11-12,14H,4-10H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | MLDMFYHAJGWIAA-JHJVBQTASA-N |
| XLogP | 1.93 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|