About tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate
tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate (PubChem CID 58359354) has the molecular formula C28H31FO4S
and a molecular weight of 482.62 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate |
| PubChem CID | 58359354 |
| Molecular Formula | C28H31FO4S |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate |
| SMILES | CCCc1cc(C2OCCO2)sc1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C28H31FO4S/c1-5-8-20-17-25(27-31-13-14-32-27)34-24(20)16-19-12-11-18(15-23(19)29)21-9-6-7-10-22(21)26(30)33-28(2,3)4/h6-7,9-12,15,17,27H,5,8,13-14,16H2,1-4H3 |
| InChIKey | KWGAJAZEPPBDFY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate?
The IUPAC name of tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate (CID 58359354) is tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate.
What is the SMILES notation for tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate?
The canonical SMILES for tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate is CCCc1cc(C2OCCO2)sc1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1F.
What is the InChIKey of tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate?
The InChIKey is KWGAJAZEPPBDFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31FO4S/c1-5-8-20-17-25(27-31-13-14-32-27)34-24(20)16-19-12-11-18(15-23(19)29)21-9-6-7-10-22(21)26(30)33-28(2,3)4/h6-7,9-12,15,17,27H,5,8,13-14,16H2,1-4H3.
What are the key properties of tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate?
tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate has a molecular weight of 482.62 g/mol, XLogP of 7.10, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-[[5-(1,3-dioxolan-2-yl)-3-propylthiophen-2-yl]methyl]-3-fluorophenyl]benzoate is sourced from PubChem (CID 58359354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).