C22H21F3O5 — CID 58360174
(Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 58360174) has the molecular formula C22H21F3O5 and a molecular weight of 422.40 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 58360174 |
| Molecular Formula | C22H21F3O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-4-(2-hydroxyphenyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2cc(F)c(F)c(F)c2)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C22H21F3O5/c23-16-10-14(11-17(24)20(16)25)22-29-12-13(6-2-1-3-9-19(27)28)21(30-22)15-7-4-5-8-18(15)26/h1-2,4-5,7-8,10-11,13,21-22,26H,3,6,9,12H2,(H,27,28)/b2-1-/t13-,21+,22+/m1/s1 |
| InChIKey | PDJBAVMUPIRYGX-HRKSNTSFSA-N |
| XLogP | 5.02 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|