C13H11F5N2O2 — CID 58360210
2-(2,2,3,3,3-pentafluoropropoxymethyl)-1,2-dihydro-[1,3]oxazolo[3,2-a]benzimidazole (PubChem CID 58360210) has the molecular formula C13H11F5N2O2 and a molecular weight of 322.23 g/mol. Its IUPAC name is 2-(2,2,3,3,3-pentafluoropropoxymethyl)-1,2-dihydro-[1,3]oxazolo[3,2-a]benzimidazole.
| Compound Name | 2-(2,2,3,3,3-pentafluoropropoxymethyl)-1,2-dihydro-[1,3]oxazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 58360210 |
| Molecular Formula | C13H11F5N2O2 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(2,2,3,3,3-pentafluoropropoxymethyl)-1,2-dihydro-[1,3]oxazolo[3,2-a]benzimidazole |
| SMILES | FC(F)(F)C(F)(F)COCC1Cn2c(nc3ccccc32)O1 |
| InChI | InChI=1S/C13H11F5N2O2/c14-12(15,13(16,17)18)7-21-6-8-5-20-10-4-2-1-3-9(10)19-11(20)22-8/h1-4,8H,5-7H2 |
| InChIKey | GSNLAWAQDYLNPV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|