C18H20FIN2O5 — CID 58360801
6-[2-[(2R)-2,3-dihydroxypropoxy]acetyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2,4-dimethylpyridazin-3-one (PubChem CID 58360801) has the molecular formula C18H20FIN2O5 and a molecular weight of 490.27 g/mol. Its IUPAC name is 6-[2-[(2R)-2,3-dihydroxypropoxy]acetyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2,4-dimethylpyridazin-3-one.
| Compound Name | 6-[2-[(2R)-2,3-dihydroxypropoxy]acetyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 58360801 |
| Molecular Formula | C18H20FIN2O5 |
| Molecular Weight | 490.27 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 6-[2-[(2R)-2,3-dihydroxypropoxy]acetyl]-5-[(2-fluoro-4-iodophenyl)methyl]-2,4-dimethylpyridazin-3-one |
| SMILES | Cc1c(Cc2ccc(I)cc2F)c(C(=O)COC[C@H](O)CO)nn(C)c1=O |
| InChI | InChI=1S/C18H20FIN2O5/c1-10-14(5-11-3-4-12(20)6-15(11)19)17(21-22(2)18(10)26)16(25)9-27-8-13(24)7-23/h3-4,6,13,23-24H,5,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | XGWBCNCUGLIQSO-CYBMUJFWSA-N |
| XLogP | 0.98 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|