C16H15FINO3 — CID 58360866
methyl 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxylate (PubChem CID 58360866) has the molecular formula C16H15FINO3 and a molecular weight of 415.20 g/mol. Its IUPAC name is methyl 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 58360866 |
| Molecular Formula | C16H15FINO3 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | methyl 2-[(2-fluoro-4-iodophenyl)methyl]-1,5-dimethyl-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C)c(=O)n(C)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C16H15FINO3/c1-9-6-12(16(21)22-3)14(19(2)15(9)20)7-10-4-5-11(18)8-13(10)17/h4-6,8H,7H2,1-3H3 |
| InChIKey | ZPBNLJWCNGNJQR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|