C31H35Cl2NO4S2 — CID 58360890
(2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-5-hexyl-4-(4-methylphenyl)sulfanyl-1-(4-methylphenyl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 58360890) has the molecular formula C31H35Cl2NO4S2 and a molecular weight of 620.66 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-5-hexyl-4-(4-methylphenyl)sulfanyl-1-(4-methylphenyl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-5-hexyl-4-(4-methylphenyl)sulfanyl-1-(4-methylphenyl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58360890 |
| Molecular Formula | C31H35Cl2NO4S2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(3,4-dichlorophenyl)-5-hexyl-4-(4-methylphenyl)sulfanyl-1-(4-methylphenyl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | CCCCCC[C@@H]1[C@@H](Sc2ccc(C)cc2)[C@@H](C(=O)O)[C@H](c2ccc(Cl)c(Cl)c2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H35Cl2NO4S2/c1-4-5-6-7-8-27-30(39-23-14-9-20(2)10-15-23)28(31(35)36)29(22-13-18-25(32)26(33)19-22)34(27)40(37,38)24-16-11-21(3)12-17-24/h9-19,27-30H,4-8H2,1-3H3,(H,35,36)/t27-,28+,29+,30-/m1/s1 |
| InChIKey | LLJPRRXHVWLBIQ-IBHPWDLASA-N |
| XLogP | 8.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|