C27H34BrNO4S2 — CID 58361030
(2R,3R,4S,5R)-2-(4-bromophenyl)-5-hexyl-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid (PubChem CID 58361030) has the molecular formula C27H34BrNO4S2 and a molecular weight of 580.61 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(4-bromophenyl)-5-hexyl-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S,5R)-2-(4-bromophenyl)-5-hexyl-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58361030 |
| Molecular Formula | C27H34BrNO4S2 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-bromophenyl)-5-hexyl-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid |
| SMILES | C=CCS[C@H]1[C@@H](C(=O)O)[C@H](c2ccc(Br)cc2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCCCCC |
| InChI | InChI=1S/C27H34BrNO4S2/c1-4-6-7-8-9-23-26(34-18-5-2)24(27(30)31)25(20-12-14-21(28)15-13-20)29(23)35(32,33)22-16-10-19(3)11-17-22/h5,10-17,23-26H,2,4,6-9,18H2,1,3H3,(H,30,31)/t23-,24+,25+,26-/m1/s1 |
| InChIKey | ZUPBHRPCNGTKAJ-KEVKATSASA-N |
| XLogP | 6.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|