About [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol
[(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol (PubChem CID 58361146) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol |
| PubChem CID | 58361146 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol |
| SMILES | CC(C)(C)N1C[C@@H](N)C[C@H]1CO |
| InChI | InChI=1S/C9H20N2O/c1-9(2,3)11-5-7(10)4-8(11)6-12/h7-8,12H,4-6,10H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | CIETYXKLNGKUGG-YUMQZZPRSA-N |
| XLogP | 0.18 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol?
The IUPAC name of [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol (CID 58361146) is [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol?
The canonical SMILES for [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol is CC(C)(C)N1C[C@@H](N)C[C@H]1CO.
What is the InChIKey of [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol?
The InChIKey is CIETYXKLNGKUGG-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H20N2O/c1-9(2,3)11-5-7(10)4-8(11)6-12/h7-8,12H,4-6,10H2,1-3H3/t7-,8-/m0/s1.
What are the key properties of [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol?
[(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol has a molecular weight of 172.27 g/mol, XLogP of 0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-amino-1-tert-butylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 58361146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).