C7H13F3O — CID 58361159
(2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-ol (PubChem CID 58361159) has the molecular formula C7H13F3O and a molecular weight of 170.17 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 58361159 |
| Molecular Formula | C7H13F3O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C7H13F3O/c1-6(2,3)4-5(11)7(8,9)10/h5,11H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | KQBICAPIVTXZKU-YFKPBYRVSA-N |
| XLogP | 2.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |