C22H35NO4 — CID 58361170
(2,5-dioxopyrrolidin-1-yl) (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 58361170) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 58361170 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)27-23-20(24)18-19-21(23)25/h6-7,9-10H,2-5,8,11-19H2,1H3/b7-6-,10-9- |
| InChIKey | DXXZWPDPHMIAHP-HZJYTTRNSA-N |
| XLogP | 5.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|