About 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate
3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate (PubChem CID 58361202) has the molecular formula C12H22O5Si
and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate.
Molecular Properties
| Compound Name | 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate |
| PubChem CID | 58361202 |
| Molecular Formula | C12H22O5Si |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H22O5Si/c1-5-6-7-9-12(13)17-10-8-11-18(14-2,15-3)16-4/h5-7,9H,8,10-11H2,1-4H3/b6-5+,9-7+ |
| InChIKey | BEEJHAQLEWGNOO-SBIWHPGTSA-N |
| XLogP | 1.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate?
The IUPAC name of 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate (CID 58361202) is 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate.
What is the SMILES notation for 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate?
The canonical SMILES for 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate is C/C=C/C=C/C(=O)OCCC[Si](OC)(OC)OC.
What is the InChIKey of 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate?
The InChIKey is BEEJHAQLEWGNOO-SBIWHPGTSA-N. The full InChI is InChI=1S/C12H22O5Si/c1-5-6-7-9-12(13)17-10-8-11-18(14-2,15-3)16-4/h5-7,9H,8,10-11H2,1-4H3/b6-5+,9-7+.
What are the key properties of 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate?
3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate has a molecular weight of 274.39 g/mol, XLogP of 1.93, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethoxysilylpropyl (2E,4E)-hexa-2,4-dienoate is sourced from PubChem (CID 58361202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).