C29H63F3O14Si7 — CID 58361466
trimethoxy-[1-[2,4,6,8-tetramethyl-8-[3-(3,3,3-trifluoropropoxy)propyl]-2,4-bis(1-trimethoxysilylethenyl)-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododec-6-yl]ethenyl]silane (PubChem CID 58361466) has the molecular formula C29H63F3O14Si7 and a molecular weight of 889.40 g/mol. Its IUPAC name is trimethoxy-[1-[2,4,6,8-tetramethyl-8-[3-(3,3,3-trifluoropropoxy)propyl]-2,4-bis(1-trimethoxysilylethenyl)-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododec-6-yl]ethenyl]silane.
| Compound Name | trimethoxy-[1-[2,4,6,8-tetramethyl-8-[3-(3,3,3-trifluoropropoxy)propyl]-2,4-bis(1-trimethoxysilylethenyl)-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododec-6-yl]ethenyl]silane |
|---|---|
| PubChem CID | 58361466 |
| Molecular Formula | C29H63F3O14Si7 |
| Molecular Weight | 889.40 g/mol |
| Exact Mass | 888.26 |
| IUPAC Name | trimethoxy-[1-[2,4,6,8-tetramethyl-8-[3-(3,3,3-trifluoropropoxy)propyl]-2,4-bis(1-trimethoxysilylethenyl)-1,3,5,7-tetraoxa-2,4,6,8-tetrasilacyclododec-6-yl]ethenyl]silane |
| SMILES | C=C([Si]1(C)OCCCC[Si](C)(CCCOCCC(F)(F)F)O[Si](C)(C(=C)[Si](OC)(OC)OC)O[Si](C)(C(=C)[Si](OC)(OC)OC)O1)[Si](OC)(OC)OC |
| InChI | InChI=1S/C29H63F3O14Si7/c1-26(51(33-4,34-5)35-6)48(14)43-22-17-18-24-47(13,25-19-21-42-23-20-29(30,31)32)44-49(15,27(2)52(36-7,37-8)38-9)46-50(16,45-48)28(3)53(39-10,40-11)41-12/h1-3,17-25H2,4-16H3 |
| InChIKey | JLKWMGSZENSYSF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 129.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.40 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|