C20H42O5SSi2 — CID 58361516
(6aS,8S,9R)-8-methyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 58361516) has the molecular formula C20H42O5SSi2 and a molecular weight of 450.79 g/mol. Its IUPAC name is (6aS,8S,9R)-8-methyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | (6aS,8S,9R)-8-methyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 58361516 |
| Molecular Formula | C20H42O5SSi2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (6aS,8S,9R)-8-methyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | CSCO[C@H]1C2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@@H]2O[C@H]1C |
| InChI | InChI=1S/C20H42O5SSi2/c1-13(2)27(14(3)4)22-11-18-20(19(17(9)23-18)21-12-26-10)24-28(25-27,15(5)6)16(7)8/h13-20H,11-12H2,1-10H3/t17-,18-,19+,20?/m0/s1 |
| InChIKey | GOOTVMGSPYEXAD-GURQWTFNSA-N |
| XLogP | 5.44 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|